C29H23F8N3O4 — CID 122362883
4-[4-(difluoromethoxy)phenyl]-6-oxo-N-pyridin-3-yl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide (PubChem CID 122362883) has the molecular formula C29H23F8N3O4 and a molecular weight of 629.50 g/mol. Its IUPAC name is 4-[4-(difluoromethoxy)phenyl]-6-oxo-N-pyridin-3-yl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide.
| Compound Name | 4-[4-(difluoromethoxy)phenyl]-6-oxo-N-pyridin-3-yl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 122362883 |
| Molecular Formula | C29H23F8N3O4 |
| Molecular Weight | 629.50 g/mol |
| Exact Mass | 629.16 |
| IUPAC Name | 4-[4-(difluoromethoxy)phenyl]-6-oxo-N-pyridin-3-yl-2-[4-(4,4,4-trifluorobutoxy)phenyl]-2-(trifluoromethyl)-1,3-dihydropyridine-5-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1=C(c2ccc(OC(F)F)cc2)CC(c2ccc(OCCCC(F)(F)F)cc2)(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C29H23F8N3O4/c30-26(31)44-21-8-4-17(5-9-21)22-15-27(29(35,36)37,18-6-10-20(11-7-18)43-14-2-12-28(32,33)34)40-25(42)23(22)24(41)39-19-3-1-13-38-16-19/h1,3-11,13,16,26H,2,12,14-15H2,(H,39,41)(H,40,42) |
| InChIKey | YDKLAEXSRMUBOK-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.50 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|