C20H17F5N2O2S — CID 122362921
(4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-[2-(trifluoromethoxy)phenyl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine (PubChem CID 122362921) has the molecular formula C20H17F5N2O2S and a molecular weight of 444.43 g/mol. Its IUPAC name is (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-[2-(trifluoromethoxy)phenyl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine.
| Compound Name | (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-[2-(trifluoromethoxy)phenyl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
|---|---|
| PubChem CID | 122362921 |
| Molecular Formula | C20H17F5N2O2S |
| Molecular Weight | 444.43 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (4aR,6R,8aS)-8a-(2,4-difluorophenyl)-6-[2-(trifluoromethoxy)phenyl]-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]thiazin-2-amine |
| SMILES | NC1=N[C@@]2(c3ccc(F)cc3F)CO[C@@H](c3ccccc3OC(F)(F)F)C[C@H]2CS1 |
| InChI | InChI=1S/C20H17F5N2O2S/c21-12-5-6-14(15(22)8-12)19-10-28-17(7-11(19)9-30-18(26)27-19)13-3-1-2-4-16(13)29-20(23,24)25/h1-6,8,11,17H,7,9-10H2,(H2,26,27)/t11-,17+,19-/m0/s1 |
| InChIKey | QTHUVEMVUWTNMD-JVMOKEISSA-N |
| XLogP | 4.90 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.43 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |