C23H23N5O — CID 122362933
(E)-3-[3-(3-cyclohexyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)phenyl]prop-2-enamide (PubChem CID 122362933) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is (E)-3-[3-(3-cyclohexyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-[3-(3-cyclohexyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122362933 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (E)-3-[3-(3-cyclohexyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)phenyl]prop-2-enamide |
| SMILES | NC(=O)/C=C/c1cccc(-c2nc3cnc4[nH]ccc4c3n2C2CCCCC2)c1 |
| InChI | InChI=1S/C23H23N5O/c24-20(29)10-9-15-5-4-6-16(13-15)23-27-19-14-26-22-18(11-12-25-22)21(19)28(23)17-7-2-1-3-8-17/h4-6,9-14,17H,1-3,7-8H2,(H2,24,29)(H,25,26)/b10-9+ |
| InChIKey | BQGOBAIIYVOGDB-MDZDMXLPSA-N |
| XLogP | 4.58 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|