C25H27N5O — CID 122362935
(E)-3-[4-(3-cyclohexyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)phenyl]-N,N-dimethylprop-2-enamide (PubChem CID 122362935) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is (E)-3-[4-(3-cyclohexyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)phenyl]-N,N-dimethylprop-2-enamide.
| Compound Name | (E)-3-[4-(3-cyclohexyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)phenyl]-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 122362935 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | (E)-3-[4-(3-cyclohexyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-4-yl)phenyl]-N,N-dimethylprop-2-enamide |
| SMILES | CN(C)C(=O)/C=C/c1ccc(-c2nc3cnc4[nH]ccc4c3n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H27N5O/c1-29(2)22(31)13-10-17-8-11-18(12-9-17)25-28-21-16-27-24-20(14-15-26-24)23(21)30(25)19-6-4-3-5-7-19/h8-16,19H,3-7H2,1-2H3,(H,26,27)/b13-10+ |
| InChIKey | BKSAEVHNGVURBS-JLHYYAGUSA-N |
| XLogP | 5.19 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|