C31H68O5Si4 — CID 122363152
[(1R)-1-[(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethoxy]-tert-butyl-dimethylsilane (PubChem CID 122363152) has the molecular formula C31H68O5Si4 and a molecular weight of 633.22 g/mol. Its IUPAC name is [(1R)-1-[(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R)-1-[(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 122363152 |
| Molecular Formula | C31H68O5Si4 |
| Molecular Weight | 633.22 g/mol |
| Exact Mass | 632.41 |
| IUPAC Name | [(1R)-1-[(2R,3S,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-3,4-dihydro-2H-pyran-2-yl]-2-[tert-butyl(dimethyl)silyl]oxyethoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H68O5Si4/c1-28(2,3)37(13,14)33-23-25(35-39(17,18)30(7,8)9)26-27(36-40(19,20)31(10,11)12)24(21-22-32-26)34-38(15,16)29(4,5)6/h21-22,24-27H,23H2,1-20H3/t24-,25-,26-,27-/m1/s1 |
| InChIKey | RJZJWPJTIMICFJ-FPCALVHFSA-N |
| XLogP | 10.09 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.22 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|