C19H10Cl2N2 — CID 122363290
11,13-dichloro-3,21-diazapentacyclo[12.7.0.02,10.04,9.015,20]henicosa-1(14),2,4,6,8,10,12,15,17,19-decaene (PubChem CID 122363290) has the molecular formula C19H10Cl2N2 and a molecular weight of 337.21 g/mol. Its IUPAC name is 11,13-dichloro-3,21-diazapentacyclo[12.7.0.02,10.04,9.015,20]henicosa-1(14),2,4,6,8,10,12,15,17,19-decaene.
| Compound Name | 11,13-dichloro-3,21-diazapentacyclo[12.7.0.02,10.04,9.015,20]henicosa-1(14),2,4,6,8,10,12,15,17,19-decaene |
|---|---|
| PubChem CID | 122363290 |
| Molecular Formula | C19H10Cl2N2 |
| Molecular Weight | 337.21 g/mol |
| Exact Mass | 336.02 |
| IUPAC Name | 11,13-dichloro-3,21-diazapentacyclo[12.7.0.02,10.04,9.015,20]henicosa-1(14),2,4,6,8,10,12,15,17,19-decaene |
| SMILES | Clc1cc(Cl)c2c([nH]c3ccccc32)c2nc3ccccc3c1-2 |
| InChI | InChI=1S/C19H10Cl2N2/c20-12-9-13(21)17-11-6-2-4-8-15(11)23-19(17)18-16(12)10-5-1-3-7-14(10)22-18/h1-9,22H |
| InChIKey | CZDVMLCIWAAVEZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.21 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |