C25H29F3O4 — CID 122363578
[(2R)-1-[(5S,6S)-5-ethenyl-5-methyl-6-(3-oxoprop-1-en-2-yl)cyclohexen-1-yl]propan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 122363578) has the molecular formula C25H29F3O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is [(2R)-1-[(5S,6S)-5-ethenyl-5-methyl-6-(3-oxoprop-1-en-2-yl)cyclohexen-1-yl]propan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2R)-1-[(5S,6S)-5-ethenyl-5-methyl-6-(3-oxoprop-1-en-2-yl)cyclohexen-1-yl]propan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 122363578 |
| Molecular Formula | C25H29F3O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | [(2R)-1-[(5S,6S)-5-ethenyl-5-methyl-6-(3-oxoprop-1-en-2-yl)cyclohexen-1-yl]propan-2-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C[C@]1(C)CCC=C(C[C@@H](C)OC(=O)[C@@](OC)(c2ccccc2)C(F)(F)F)[C@@H]1C(=C)C=O |
| InChI | InChI=1S/C25H29F3O4/c1-6-23(4)14-10-11-19(21(23)17(2)16-29)15-18(3)32-22(30)24(31-5,25(26,27)28)20-12-8-7-9-13-20/h6-9,11-13,16,18,21H,1-2,10,14-15H2,3-5H3/t18-,21+,23-,24+/m1/s1 |
| InChIKey | ODQBJGWUWUUVAO-LJAMWKNPSA-N |
| XLogP | 5.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|