C16H8N4O2S — CID 122363931
15-(furan-2-yl)-11-thia-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,9,12,14-heptaen-8-one (PubChem CID 122363931) has the molecular formula C16H8N4O2S and a molecular weight of 320.33 g/mol. Its IUPAC name is 15-(furan-2-yl)-11-thia-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,9,12,14-heptaen-8-one.
| Compound Name | 15-(furan-2-yl)-11-thia-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,9,12,14-heptaen-8-one |
|---|---|
| PubChem CID | 122363931 |
| Molecular Formula | C16H8N4O2S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 15-(furan-2-yl)-11-thia-13,14,16,17-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(17),2,4,6,9,12,14-heptaen-8-one |
| SMILES | O=c1cc2sc3nnc(-c4ccco4)n3nc-2c2ccccc12 |
| InChI | InChI=1S/C16H8N4O2S/c21-11-8-13-14(10-5-2-1-4-9(10)11)19-20-15(12-6-3-7-22-12)17-18-16(20)23-13/h1-8H |
| InChIKey | XEKTZDNSIUBDRO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|