About (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate
(4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate (PubChem CID 122363992) has the molecular formula C20H26N2S
and a molecular weight of 326.51 g/mol. Its IUPAC name is (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate.
Molecular Properties
| Compound Name | (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate |
| PubChem CID | 122363992 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate |
| SMILES | CCN(CC)/C(=N/c1c(C)cccc1C)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C20H26N2S/c1-6-22(7-2)20(23-18-13-11-15(3)12-14-18)21-19-16(4)9-8-10-17(19)5/h8-14H,6-7H2,1-5H3/b21-20- |
| InChIKey | XPMLRYQEFMCPNQ-MRCUWXFGSA-N |
| XLogP | 5.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate?
The IUPAC name of (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate (CID 122363992) is (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate.
What is the SMILES notation for (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate?
The canonical SMILES for (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate is CCN(CC)/C(=N/c1c(C)cccc1C)Sc1ccc(C)cc1.
What is the InChIKey of (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate?
The InChIKey is XPMLRYQEFMCPNQ-MRCUWXFGSA-N. The full InChI is InChI=1S/C20H26N2S/c1-6-22(7-2)20(23-18-13-11-15(3)12-14-18)21-19-16(4)9-8-10-17(19)5/h8-14H,6-7H2,1-5H3/b21-20-.
What are the key properties of (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate?
(4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate has a molecular weight of 326.51 g/mol, XLogP of 5.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) N'-(2,6-dimethylphenyl)-N,N-diethylcarbamimidothioate is sourced from PubChem (CID 122363992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).