About phenyl N'-benzyl-N,N-diethylcarbamimidothioate
phenyl N'-benzyl-N,N-diethylcarbamimidothioate (PubChem CID 122363995) has the molecular formula C18H22N2S
and a molecular weight of 298.45 g/mol. Its IUPAC name is phenyl N'-benzyl-N,N-diethylcarbamimidothioate.
Molecular Properties
| Compound Name | phenyl N'-benzyl-N,N-diethylcarbamimidothioate |
| PubChem CID | 122363995 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | phenyl N'-benzyl-N,N-diethylcarbamimidothioate |
| SMILES | CCN(CC)/C(=N\Cc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C18H22N2S/c1-3-20(4-2)18(21-17-13-9-6-10-14-17)19-15-16-11-7-5-8-12-16/h5-14H,3-4,15H2,1-2H3/b19-18+ |
| InChIKey | NWMWHLUXLXQHNL-VHEBQXMUSA-N |
| XLogP | 4.68 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze phenyl N'-benzyl-N,N-diethylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N'-benzyl-N,N-diethylcarbamimidothioate?
The IUPAC name of phenyl N'-benzyl-N,N-diethylcarbamimidothioate (CID 122363995) is phenyl N'-benzyl-N,N-diethylcarbamimidothioate.
What is the SMILES notation for phenyl N'-benzyl-N,N-diethylcarbamimidothioate?
The canonical SMILES for phenyl N'-benzyl-N,N-diethylcarbamimidothioate is CCN(CC)/C(=N\Cc1ccccc1)Sc1ccccc1.
What is the InChIKey of phenyl N'-benzyl-N,N-diethylcarbamimidothioate?
The InChIKey is NWMWHLUXLXQHNL-VHEBQXMUSA-N. The full InChI is InChI=1S/C18H22N2S/c1-3-20(4-2)18(21-17-13-9-6-10-14-17)19-15-16-11-7-5-8-12-16/h5-14H,3-4,15H2,1-2H3/b19-18+.
What are the key properties of phenyl N'-benzyl-N,N-diethylcarbamimidothioate?
phenyl N'-benzyl-N,N-diethylcarbamimidothioate has a molecular weight of 298.45 g/mol, XLogP of 4.68, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N'-benzyl-N,N-diethylcarbamimidothioate is sourced from PubChem (CID 122363995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).