C6H12N2O — CID 12236517
4-Methyl-1,4-diazepan-2-one (PubChem CID 12236517) has the molecular formula C6H12N2O and a molecular weight of 128.17 g/mol. Its IUPAC name is 4-methyl-1,4-diazepan-2-one.
| Compound Name | 4-Methyl-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 12236517 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | 4-methyl-1,4-diazepan-2-one |
| SMILES | CN1CCCNC(=O)C1 |
| InChI | InChI=1S/C6H12N2O/c1-8-4-2-3-7-6(9)5-8/h2-5H2,1H3,(H,7,9) |
| InChIKey | AIRVCSGEUIGZQP-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 32.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | 114 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |