About (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene]
(4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene] (PubChem CID 122365542) has the molecular formula C19H14N2S
and a molecular weight of 302.40 g/mol. Its IUPAC name is (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene].
Molecular Properties
| Compound Name | (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene] |
| PubChem CID | 122365542 |
| Molecular Formula | C19H14N2S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene] |
| SMILES | C1=N[C@@H](c2cccs2)C2(N1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C19H14N2S/c1-3-8-15-13(6-1)14-7-2-4-9-16(14)19(15)18(20-12-21-19)17-10-5-11-22-17/h1-12,18H,(H,20,21)/t18-/m0/s1 |
| InChIKey | ZVYQIWPRYJLXCL-SFHVURJKSA-N |
| XLogP | 4.34 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene]?
The IUPAC name of (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene] (CID 122365542) is (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene].
What is the SMILES notation for (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene]?
The canonical SMILES for (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene] is C1=N[C@@H](c2cccs2)C2(N1)c1ccccc1-c1ccccc12.
What is the InChIKey of (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene]?
The InChIKey is ZVYQIWPRYJLXCL-SFHVURJKSA-N. The full InChI is InChI=1S/C19H14N2S/c1-3-8-15-13(6-1)14-7-2-4-9-16(14)19(15)18(20-12-21-19)17-10-5-11-22-17/h1-12,18H,(H,20,21)/t18-/m0/s1.
What are the key properties of (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene]?
(4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene] has a molecular weight of 302.40 g/mol, XLogP of 4.34, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-thiophen-2-ylspiro[1,4-dihydroimidazole-5,9'-fluorene] is sourced from PubChem (CID 122365542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).