C17H23N3O2 — CID 122366067
(5S)-4-benzyl-5-butan-2-yl-2-prop-2-enyl-1,2,4-triazinane-3,6-dione (PubChem CID 122366067) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (5S)-4-benzyl-5-butan-2-yl-2-prop-2-enyl-1,2,4-triazinane-3,6-dione.
| Compound Name | (5S)-4-benzyl-5-butan-2-yl-2-prop-2-enyl-1,2,4-triazinane-3,6-dione |
|---|---|
| PubChem CID | 122366067 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (5S)-4-benzyl-5-butan-2-yl-2-prop-2-enyl-1,2,4-triazinane-3,6-dione |
| SMILES | C=CCN1NC(=O)[C@H](C(C)CC)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C17H23N3O2/c1-4-11-20-17(22)19(12-14-9-7-6-8-10-14)15(13(3)5-2)16(21)18-20/h4,6-10,13,15H,1,5,11-12H2,2-3H3,(H,18,21)/t13?,15-/m0/s1 |
| InChIKey | QNRGFUYVVSSUOR-WUJWULDRSA-N |
| XLogP | 2.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|