C33H56N2+2 — CID 122366089
(3,5-ditert-butylphenyl)methyl-[3-[(3,5-ditert-butylphenyl)methylazaniumyl]propyl]azanium (PubChem CID 122366089) has the molecular formula C33H56N2+2 and a molecular weight of 480.83 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl)methyl-[3-[(3,5-ditert-butylphenyl)methylazaniumyl]propyl]azanium.
| Compound Name | (3,5-ditert-butylphenyl)methyl-[3-[(3,5-ditert-butylphenyl)methylazaniumyl]propyl]azanium |
|---|---|
| PubChem CID | 122366089 |
| Molecular Formula | C33H56N2+2 |
| Molecular Weight | 480.83 g/mol |
| Exact Mass | 480.44 |
| IUPAC Name | (3,5-ditert-butylphenyl)methyl-[3-[(3,5-ditert-butylphenyl)methylazaniumyl]propyl]azanium |
| SMILES | CC(C)(C)c1cc(C[NH2+]CCC[NH2+]Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H54N2/c1-30(2,3)26-16-24(17-27(20-26)31(4,5)6)22-34-14-13-15-35-23-25-18-28(32(7,8)9)21-29(19-25)33(10,11)12/h16-21,34-35H,13-15,22-23H2,1-12H3/p+2 |
| InChIKey | FZSIGHKBYVHKLU-UHFFFAOYSA-P |
| XLogP | 6.09 |
| TPSA | 33.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.83 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|