C34H30N2O5 — CID 122366199
(2S)-2-[[(2S)-2-[(2-phenanthren-9-yloxyacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (PubChem CID 122366199) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(2-phenanthren-9-yloxyacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[(2-phenanthren-9-yloxyacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 122366199 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2-phenanthren-9-yloxyacetyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(COc1cc2ccccc2c2ccccc12)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C34H30N2O5/c37-32(22-41-31-21-25-15-7-8-16-26(25)27-17-9-10-18-28(27)31)35-29(19-23-11-3-1-4-12-23)33(38)36-30(34(39)40)20-24-13-5-2-6-14-24/h1-18,21,29-30H,19-20,22H2,(H,35,37)(H,36,38)(H,39,40)/t29-,30-/m0/s1 |
| InChIKey | SADGDTSXCHBUFL-KYJUHHDHSA-N |
| XLogP | 4.91 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|