C8H12FNO5 — CID 122366443
(4R,4aR,5S,6S,7S)-4-fluoro-5,6-dihydroxy-7-(hydroxymethyl)-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one (PubChem CID 122366443) has the molecular formula C8H12FNO5 and a molecular weight of 221.18 g/mol. Its IUPAC name is (4R,4aR,5S,6S,7S)-4-fluoro-5,6-dihydroxy-7-(hydroxymethyl)-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one.
| Compound Name | (4R,4aR,5S,6S,7S)-4-fluoro-5,6-dihydroxy-7-(hydroxymethyl)-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
|---|---|
| PubChem CID | 122366443 |
| Molecular Formula | C8H12FNO5 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (4R,4aR,5S,6S,7S)-4-fluoro-5,6-dihydroxy-7-(hydroxymethyl)-3,4,4a,5,6,7-hexahydropyrrolo[1,2-c][1,3]oxazin-1-one |
| SMILES | O=C1OC[C@H](F)[C@H]2[C@H](O)[C@@H](O)[C@H](CO)N12 |
| InChI | InChI=1S/C8H12FNO5/c9-3-2-15-8(14)10-4(1-11)6(12)7(13)5(3)10/h3-7,11-13H,1-2H2/t3-,4-,5-,6-,7-/m0/s1 |
| InChIKey | ZGGPURGFZBXZHN-RRNSMKEASA-N |
| XLogP | -1.76 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |