C17H33BO2 — CID 122366992
2-(2,2-dipropylpent-4-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 122366992) has the molecular formula C17H33BO2 and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-(2,2-dipropylpent-4-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2,2-dipropylpent-4-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 122366992 |
| Molecular Formula | C17H33BO2 |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.26 |
| IUPAC Name | 2-(2,2-dipropylpent-4-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | C=CCC(CCC)(CCC)CB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H33BO2/c1-8-11-17(12-9-2,13-10-3)14-18-19-15(4,5)16(6,7)20-18/h8H,1,9-14H2,2-7H3 |
| InChIKey | XVONGCBQMDEHJW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|