C21H22F3N3O2S2 — CID 122367723
4-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine (PubChem CID 122367723) has the molecular formula C21H22F3N3O2S2 and a molecular weight of 469.55 g/mol. Its IUPAC name is 4-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine.
| Compound Name | 4-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
|---|---|
| PubChem CID | 122367723 |
| Molecular Formula | C21H22F3N3O2S2 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 4-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2-[5-(trifluoromethyl)-1H-pyrazol-3-yl]pyridine |
| SMILES | CCCCCCSc1sc(-c2ccnc(-c3cc(C(F)(F)F)[nH]n3)c2)c2c1OCCO2 |
| InChI | InChI=1S/C21H22F3N3O2S2/c1-2-3-4-5-10-30-20-18-17(28-8-9-29-18)19(31-20)13-6-7-25-14(11-13)15-12-16(27-26-15)21(22,23)24/h6-7,11-12H,2-5,8-10H2,1H3,(H,26,27) |
| InChIKey | OWYGDXCBJYRDRK-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|