About [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane
[3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane (PubChem CID 122367910) has the molecular formula C19H29BBrNSi
and a molecular weight of 390.25 g/mol. Its IUPAC name is [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane.
Molecular Properties
| Compound Name | [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane |
| PubChem CID | 122367910 |
| Molecular Formula | C19H29BBrNSi |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane |
| SMILES | Cc1cc(C)c(B2C(Br)=CC=CN2[Si](C)(C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C19H29BBrNSi/c1-14-12-15(2)18(16(3)13-14)20-17(21)10-9-11-22(20)23(7,8)19(4,5)6/h9-13H,1-8H3 |
| InChIKey | RLAFKJSIIDIIGB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane?
The IUPAC name of [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane (CID 122367910) is [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane.
What is the SMILES notation for [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane?
The canonical SMILES for [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane is Cc1cc(C)c(B2C(Br)=CC=CN2[Si](C)(C)C(C)(C)C)c(C)c1.
What is the InChIKey of [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane?
The InChIKey is RLAFKJSIIDIIGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H29BBrNSi/c1-14-12-15(2)18(16(3)13-14)20-17(21)10-9-11-22(20)23(7,8)19(4,5)6/h9-13H,1-8H3.
What are the key properties of [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane?
[3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane has a molecular weight of 390.25 g/mol, XLogP of 5.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [3-bromo-2-(2,4,6-trimethylphenyl)azaborinin-1-yl]-tert-butyl-dimethylsilane is sourced from PubChem (CID 122367910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).