C42H36N2P2 — CID 122368052
(14R,15R)-2,5,14,15-tetraphenyl-13,16-diaza-2,5-diphosphatricyclo[16.4.0.06,11]docosa-1(22),6,8,10,12,16,18,20-octaene (PubChem CID 122368052) has the molecular formula C42H36N2P2 and a molecular weight of 630.71 g/mol. Its IUPAC name is (14R,15R)-2,5,14,15-tetraphenyl-13,16-diaza-2,5-diphosphatricyclo[16.4.0.06,11]docosa-1(22),6,8,10,12,16,18,20-octaene.
| Compound Name | (14R,15R)-2,5,14,15-tetraphenyl-13,16-diaza-2,5-diphosphatricyclo[16.4.0.06,11]docosa-1(22),6,8,10,12,16,18,20-octaene |
|---|---|
| PubChem CID | 122368052 |
| Molecular Formula | C42H36N2P2 |
| Molecular Weight | 630.71 g/mol |
| Exact Mass | 630.24 |
| IUPAC Name | (14R,15R)-2,5,14,15-tetraphenyl-13,16-diaza-2,5-diphosphatricyclo[16.4.0.06,11]docosa-1(22),6,8,10,12,16,18,20-octaene |
| SMILES | C1=N/[C@H](c2ccccc2)[C@@H](c2ccccc2)/N=C/c2ccccc2[P@](c2ccccc2)CC[P@@](c2ccccc2)c2ccccc2/1 |
| InChI | InChI=1S/C42H36N2P2/c1-5-17-33(18-6-1)41-42(34-19-7-2-8-20-34)44-32-36-22-14-16-28-40(36)46(38-25-11-4-12-26-38)30-29-45(37-23-9-3-10-24-37)39-27-15-13-21-35(39)31-43-41/h1-28,31-32,41-42H,29-30H2/b43-31+,44-32+/t41-,42-,45+,46+/m1/s1 |
| InChIKey | UJBMDTXNSFLBRR-MZNXWZQQSA-N |
| XLogP | 8.59 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.71 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|