C39H50N4O2S2 — CID 122368383
(1R,4R,5R,9R,10R,12S)-5,9-dimethyl-5-N,14-N-bis[(3-methylphenyl)carbamothioyl]-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,14-dicarboxamide (PubChem CID 122368383) has the molecular formula C39H50N4O2S2 and a molecular weight of 670.99 g/mol. Its IUPAC name is (1R,4R,5R,9R,10R,12S)-5,9-dimethyl-5-N,14-N-bis[(3-methylphenyl)carbamothioyl]-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,14-dicarboxamide.
| Compound Name | (1R,4R,5R,9R,10R,12S)-5,9-dimethyl-5-N,14-N-bis[(3-methylphenyl)carbamothioyl]-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,14-dicarboxamide |
|---|---|
| PubChem CID | 122368383 |
| Molecular Formula | C39H50N4O2S2 |
| Molecular Weight | 670.99 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | (1R,4R,5R,9R,10R,12S)-5,9-dimethyl-5-N,14-N-bis[(3-methylphenyl)carbamothioyl]-16-propan-2-yltetracyclo[10.2.2.01,10.04,9]hexadec-15-ene-5,14-dicarboxamide |
| SMILES | Cc1cccc(NC(=S)NC(=O)C2C[C@@H]3C[C@@H]4[C@@]5(C)CCC[C@@](C)(C(=O)NC(=S)Nc6cccc(C)c6)[C@@H]5CC[C@]24C=C3C(C)C)c1 |
| InChI | InChI=1S/C39H50N4O2S2/c1-23(2)29-22-39-17-14-31-37(5,15-9-16-38(31,6)34(45)43-36(47)41-28-13-8-11-25(4)19-28)32(39)21-26(29)20-30(39)33(44)42-35(46)40-27-12-7-10-24(3)18-27/h7-8,10-13,18-19,22-23,26,30-32H,9,14-17,20-21H2,1-6H3,(H2,40,42,44,46)(H2,41,43,45,47)/t26-,30?,31-,32-,37+,38-,39+/m1/s1 |
| InChIKey | QDOAEIVSSLLWAS-MGRCOULWSA-N |
| XLogP | 8.46 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.99 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|