C14H20O3 — CID 122368409
(4R,5S,6S,7R)-4-ethenyl-6-hydroxy-3,3,5-trimethylspiro[bicyclo[3.2.1]octane-7,2'-oxirane]-2-one (PubChem CID 122368409) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (4R,5S,6S,7R)-4-ethenyl-6-hydroxy-3,3,5-trimethylspiro[bicyclo[3.2.1]octane-7,2'-oxirane]-2-one.
| Compound Name | (4R,5S,6S,7R)-4-ethenyl-6-hydroxy-3,3,5-trimethylspiro[bicyclo[3.2.1]octane-7,2'-oxirane]-2-one |
|---|---|
| PubChem CID | 122368409 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (4R,5S,6S,7R)-4-ethenyl-6-hydroxy-3,3,5-trimethylspiro[bicyclo[3.2.1]octane-7,2'-oxirane]-2-one |
| SMILES | C=C[C@H]1C(C)(C)C(=O)C2C[C@]1(C)[C@H](O)[C@]21CO1 |
| InChI | InChI=1S/C14H20O3/c1-5-9-12(2,3)10(15)8-6-13(9,4)11(16)14(8)7-17-14/h5,8-9,11,16H,1,6-7H2,2-4H3/t8?,9-,11-,13-,14-/m0/s1 |
| InChIKey | HDJZYYXZOYXXJR-TUYPERFGSA-N |
| XLogP | 1.55 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|