C15H15Cl2NO2Si — CID 122369508
10,10-dichloro-1,9-dimethoxy-5-methylbenzo[b][1,4]benzazasiline (PubChem CID 122369508) has the molecular formula C15H15Cl2NO2Si and a molecular weight of 340.28 g/mol. Its IUPAC name is 10,10-dichloro-1,9-dimethoxy-5-methylbenzo[b][1,4]benzazasiline.
| Compound Name | 10,10-dichloro-1,9-dimethoxy-5-methylbenzo[b][1,4]benzazasiline |
|---|---|
| PubChem CID | 122369508 |
| Molecular Formula | C15H15Cl2NO2Si |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 10,10-dichloro-1,9-dimethoxy-5-methylbenzo[b][1,4]benzazasiline |
| SMILES | COc1cccc2c1[Si](Cl)(Cl)c1c(OC)cccc1N2C |
| InChI | InChI=1S/C15H15Cl2NO2Si/c1-18-10-6-4-8-12(19-2)14(10)21(16,17)15-11(18)7-5-9-13(15)20-3/h4-9H,1-3H3 |
| InChIKey | HVHNDKHTVNFDSB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|