About [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane
[(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane (PubChem CID 122369690) has the molecular formula C11H20F2Si
and a molecular weight of 218.36 g/mol. Its IUPAC name is [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane.
Molecular Properties
| Compound Name | [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane |
| PubChem CID | 122369690 |
| Molecular Formula | C11H20F2Si |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane |
| SMILES | C=CC/C(F)=C(\F)[Si](CC)(CC)CC |
| InChI | InChI=1S/C11H20F2Si/c1-5-9-10(12)11(13)14(6-2,7-3)8-4/h5H,1,6-9H2,2-4H3/b11-10- |
| InChIKey | XLWJAPRAUCEMGY-KHPPLWFESA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane?
The IUPAC name of [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane (CID 122369690) is [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane.
What is the SMILES notation for [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane?
The canonical SMILES for [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane is C=CC/C(F)=C(\F)[Si](CC)(CC)CC.
What is the InChIKey of [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane?
The InChIKey is XLWJAPRAUCEMGY-KHPPLWFESA-N. The full InChI is InChI=1S/C11H20F2Si/c1-5-9-10(12)11(13)14(6-2,7-3)8-4/h5H,1,6-9H2,2-4H3/b11-10-.
What are the key properties of [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane?
[(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane has a molecular weight of 218.36 g/mol, XLogP of 4.76, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(1Z)-1,2-difluoropenta-1,4-dienyl]-triethylsilane is sourced from PubChem (CID 122369690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).