C10H10FNO2 — CID 122369709
(NZ)-N-[(4S,5S)-4-fluoro-5-phenyloxolan-2-ylidene]hydroxylamine (PubChem CID 122369709) has the molecular formula C10H10FNO2 and a molecular weight of 195.19 g/mol. Its IUPAC name is (NZ)-N-[(4S,5S)-4-fluoro-5-phenyloxolan-2-ylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(4S,5S)-4-fluoro-5-phenyloxolan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 122369709 |
| Molecular Formula | C10H10FNO2 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (NZ)-N-[(4S,5S)-4-fluoro-5-phenyloxolan-2-ylidene]hydroxylamine |
| SMILES | O/N=C1/C[C@H](F)[C@H](c2ccccc2)O1 |
| InChI | InChI=1S/C10H10FNO2/c11-8-6-9(12-13)14-10(8)7-4-2-1-3-5-7/h1-5,8,10,13H,6H2/b12-9-/t8-,10-/m0/s1 |
| InChIKey | BEWOWDNMVBYRLJ-PCIFLVGJSA-N |
| XLogP | 2.27 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|