C11H11NO4 — CID 122369713
methyl 2-(7-hydroxy-2-oxo-1,3-dihydroindol-3-yl)acetate (PubChem CID 122369713) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is methyl 2-(7-hydroxy-2-oxo-1,3-dihydroindol-3-yl)acetate.
| Compound Name | methyl 2-(7-hydroxy-2-oxo-1,3-dihydroindol-3-yl)acetate |
|---|---|
| PubChem CID | 122369713 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | methyl 2-(7-hydroxy-2-oxo-1,3-dihydroindol-3-yl)acetate |
| SMILES | COC(=O)CC1C(=O)Nc2c(O)cccc21 |
| InChI | InChI=1S/C11H11NO4/c1-16-9(14)5-7-6-3-2-4-8(13)10(6)12-11(7)15/h2-4,7,13H,5H2,1H3,(H,12,15) |
| InChIKey | JGPLAXJADUJXRS-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|