C18H13N3O4 — CID 122370145
4-(2,5-dioxopyrrol-1-yl)-N-(phenylcarbamoyl)benzamide (PubChem CID 122370145) has the molecular formula C18H13N3O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)-N-(phenylcarbamoyl)benzamide.
| Compound Name | 4-(2,5-dioxopyrrol-1-yl)-N-(phenylcarbamoyl)benzamide |
|---|---|
| PubChem CID | 122370145 |
| Molecular Formula | C18H13N3O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-(2,5-dioxopyrrol-1-yl)-N-(phenylcarbamoyl)benzamide |
| SMILES | O=C(NC(=O)c1ccc(N2C(=O)C=CC2=O)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C18H13N3O4/c22-15-10-11-16(23)21(15)14-8-6-12(7-9-14)17(24)20-18(25)19-13-4-2-1-3-5-13/h1-11H,(H2,19,20,24,25) |
| InChIKey | XXWPPEWFSKFHPP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|