About bis(3,5-diphenylphenyl)diazene
bis(3,5-diphenylphenyl)diazene (PubChem CID 122370501) has the molecular formula C36H26N2
and a molecular weight of 486.62 g/mol. Its IUPAC name is bis(3,5-diphenylphenyl)diazene.
Molecular Properties
| Compound Name | bis(3,5-diphenylphenyl)diazene |
| PubChem CID | 122370501 |
| Molecular Formula | C36H26N2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | bis(3,5-diphenylphenyl)diazene |
| SMILES | c1ccc(-c2cc(/N=N/c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C36H26N2/c1-5-13-27(14-6-1)31-21-32(28-15-7-2-8-16-28)24-35(23-31)37-38-36-25-33(29-17-9-3-10-18-29)22-34(26-36)30-19-11-4-12-20-30/h1-26H/b38-37+ |
| InChIKey | CTNAIPWMSHLJOZ-HEFFKOSUSA-N |
| XLogP | 10.77 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(3,5-diphenylphenyl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3,5-diphenylphenyl)diazene?
The IUPAC name of bis(3,5-diphenylphenyl)diazene (CID 122370501) is bis(3,5-diphenylphenyl)diazene.
What is the SMILES notation for bis(3,5-diphenylphenyl)diazene?
The canonical SMILES for bis(3,5-diphenylphenyl)diazene is c1ccc(-c2cc(/N=N/c3cc(-c4ccccc4)cc(-c4ccccc4)c3)cc(-c3ccccc3)c2)cc1.
What is the InChIKey of bis(3,5-diphenylphenyl)diazene?
The InChIKey is CTNAIPWMSHLJOZ-HEFFKOSUSA-N. The full InChI is InChI=1S/C36H26N2/c1-5-13-27(14-6-1)31-21-32(28-15-7-2-8-16-28)24-35(23-31)37-38-36-25-33(29-17-9-3-10-18-29)22-34(26-36)30-19-11-4-12-20-30/h1-26H/b38-37+.
What are the key properties of bis(3,5-diphenylphenyl)diazene?
bis(3,5-diphenylphenyl)diazene has a molecular weight of 486.62 g/mol, XLogP of 10.77, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3,5-diphenylphenyl)diazene is sourced from PubChem (CID 122370501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).