C15H17FO3 — CID 122370564
14-fluoro-15-methyl-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-11,13-dione (PubChem CID 122370564) has the molecular formula C15H17FO3 and a molecular weight of 264.30 g/mol. Its IUPAC name is 14-fluoro-15-methyl-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-11,13-dione.
| Compound Name | 14-fluoro-15-methyl-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-11,13-dione |
|---|---|
| PubChem CID | 122370564 |
| Molecular Formula | C15H17FO3 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 14-fluoro-15-methyl-12-oxapentacyclo[4.4.3.12,5.17,10.01,6]pentadecane-11,13-dione |
| SMILES | CC1C2CCC1C13C(=O)OC(=O)C21C1CCC3C1F |
| InChI | InChI=1S/C15H17FO3/c1-6-7-2-3-8(6)15-10-5-4-9(11(10)16)14(7,15)12(17)19-13(15)18/h6-11H,2-5H2,1H3 |
| InChIKey | KBKSEJVWYJHELT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|