C48H28N2O2S2 — CID 122371839
S-[4-[2-[4-[2-[8-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]phenyl]ethynyl]-1,10-phenanthrolin-3-yl]ethynyl]phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 122371839) has the molecular formula C48H28N2O2S2 and a molecular weight of 728.90 g/mol. Its IUPAC name is S-[4-[2-[4-[2-[8-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]phenyl]ethynyl]-1,10-phenanthrolin-3-yl]ethynyl]phenyl]ethynyl]phenyl] ethanethioate.
| Compound Name | S-[4-[2-[4-[2-[8-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]phenyl]ethynyl]-1,10-phenanthrolin-3-yl]ethynyl]phenyl]ethynyl]phenyl] ethanethioate |
|---|---|
| PubChem CID | 122371839 |
| Molecular Formula | C48H28N2O2S2 |
| Molecular Weight | 728.90 g/mol |
| Exact Mass | 728.16 |
| IUPAC Name | S-[4-[2-[4-[2-[8-[2-[4-[2-(4-acetylsulfanylphenyl)ethynyl]phenyl]ethynyl]-1,10-phenanthrolin-3-yl]ethynyl]phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(C#Cc2ccc(C#Cc3cnc4c(ccc5cc(C#Cc6ccc(C#Cc7ccc(SC(C)=O)cc7)cc6)cnc54)c3)cc2)cc1 |
| InChI | InChI=1S/C48H28N2O2S2/c1-33(51)53-45-25-19-39(20-26-45)13-11-35-3-7-37(8-4-35)15-17-41-29-43-23-24-44-30-42(32-50-48(44)47(43)49-31-41)18-16-38-9-5-36(6-10-38)12-14-40-21-27-46(28-22-40)54-34(2)52/h3-10,19-32H,1-2H3 |
| InChIKey | ZJQOKVGJNCNSQZ-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.90 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|