C11H20N4O3 — CID 122371884
(3aR,7R,7aS)-5-(3-azidopropyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol (PubChem CID 122371884) has the molecular formula C11H20N4O3 and a molecular weight of 256.31 g/mol. Its IUPAC name is (3aR,7R,7aS)-5-(3-azidopropyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol.
| Compound Name | (3aR,7R,7aS)-5-(3-azidopropyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
|---|---|
| PubChem CID | 122371884 |
| Molecular Formula | C11H20N4O3 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (3aR,7R,7aS)-5-(3-azidopropyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-7-ol |
| SMILES | CC1(C)O[C@H]2[C@H](O)CN(CCCN=[N+]=[N-])C[C@H]2O1 |
| InChI | InChI=1S/C11H20N4O3/c1-11(2)17-9-7-15(5-3-4-13-14-12)6-8(16)10(9)18-11/h8-10,16H,3-7H2,1-2H3/t8-,9-,10+/m1/s1 |
| InChIKey | FCEFAKLDGXCHOW-BBBLOLIVSA-N |
| XLogP | 0.88 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|