About tricyclo[4.2.0.02,4]oct-5-ene
tricyclo[4.2.0.02,4]oct-5-ene (PubChem CID 122372098) has the molecular formula C8H10
and a molecular weight of 106.17 g/mol. Its IUPAC name is tricyclo[4.2.0.02,4]oct-5-ene.
Molecular Properties
| Compound Name | tricyclo[4.2.0.02,4]oct-5-ene |
| PubChem CID | 122372098 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | tricyclo[4.2.0.02,4]oct-5-ene |
| SMILES | C1=C2CCC2C2CC12 |
| InChI | InChI=1S/C8H10/c1-2-7-5(1)3-6-4-8(6)7/h3,6-8H,1-2,4H2 |
| InChIKey | ZFMRBXRTVXBYSG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[4.2.0.02,4]oct-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[4.2.0.02,4]oct-5-ene?
The IUPAC name of tricyclo[4.2.0.02,4]oct-5-ene (CID 122372098) is tricyclo[4.2.0.02,4]oct-5-ene.
What is the SMILES notation for tricyclo[4.2.0.02,4]oct-5-ene?
The canonical SMILES for tricyclo[4.2.0.02,4]oct-5-ene is C1=C2CCC2C2CC12.
What is the InChIKey of tricyclo[4.2.0.02,4]oct-5-ene?
The InChIKey is ZFMRBXRTVXBYSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10/c1-2-7-5(1)3-6-4-8(6)7/h3,6-8H,1-2,4H2.
What are the key properties of tricyclo[4.2.0.02,4]oct-5-ene?
tricyclo[4.2.0.02,4]oct-5-ene has a molecular weight of 106.17 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[4.2.0.02,4]oct-5-ene is sourced from PubChem (CID 122372098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).