About (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol
(R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol (PubChem CID 122372363) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol.
Molecular Properties
| Compound Name | (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol |
| PubChem CID | 122372363 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol |
| SMILES | C=CCN1[C@H]([C@H](O)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-2-13-19-16(14-9-5-3-6-10-14)17(19)18(20)15-11-7-4-8-12-15/h2-12,16-18,20H,1,13H2/t16-,17+,18-,19?/m1/s1 |
| InChIKey | BAPWBAAGRQITGC-MHYDHLEJSA-N |
| XLogP | 3.33 |
| TPSA | 23.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol?
The IUPAC name of (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol (CID 122372363) is (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol.
What is the SMILES notation for (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol?
The canonical SMILES for (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol is C=CCN1[C@H]([C@H](O)c2ccccc2)[C@H]1c1ccccc1.
What is the InChIKey of (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol?
The InChIKey is BAPWBAAGRQITGC-MHYDHLEJSA-N. The full InChI is InChI=1S/C18H19NO/c1-2-13-19-16(14-9-5-3-6-10-14)17(19)18(20)15-11-7-4-8-12-15/h2-12,16-18,20H,1,13H2/t16-,17+,18-,19?/m1/s1.
What are the key properties of (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol?
(R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol has a molecular weight of 265.36 g/mol, XLogP of 3.33, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-phenyl-[(2S,3R)-3-phenyl-1-prop-2-enylaziridin-2-yl]methanol is sourced from PubChem (CID 122372363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).