C32H37N3O4 — CID 122372384
2-(1,1,4,8b-tetramethyl-2-oxo-3-phenylmethoxy-3aH-pyrrolo[2,3-b]indol-5-yl)-2-methyl-N-phenylmethoxypropanamide (PubChem CID 122372384) has the molecular formula C32H37N3O4 and a molecular weight of 527.67 g/mol. Its IUPAC name is 2-(1,1,4,8b-tetramethyl-2-oxo-3-phenylmethoxy-3aH-pyrrolo[2,3-b]indol-5-yl)-2-methyl-N-phenylmethoxypropanamide.
| Compound Name | 2-(1,1,4,8b-tetramethyl-2-oxo-3-phenylmethoxy-3aH-pyrrolo[2,3-b]indol-5-yl)-2-methyl-N-phenylmethoxypropanamide |
|---|---|
| PubChem CID | 122372384 |
| Molecular Formula | C32H37N3O4 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.28 |
| IUPAC Name | 2-(1,1,4,8b-tetramethyl-2-oxo-3-phenylmethoxy-3aH-pyrrolo[2,3-b]indol-5-yl)-2-methyl-N-phenylmethoxypropanamide |
| SMILES | CN1c2c(C(C)(C)C(=O)NOCc3ccccc3)cccc2C2(C)C1N(OCc1ccccc1)C(=O)C2(C)C |
| InChI | InChI=1S/C32H37N3O4/c1-30(2,27(36)33-38-20-22-14-9-7-10-15-22)24-18-13-19-25-26(24)34(6)28-32(25,5)31(3,4)29(37)35(28)39-21-23-16-11-8-12-17-23/h7-19,28H,20-21H2,1-6H3,(H,33,36) |
| InChIKey | FLXPZQYADSBKCL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|