C30H49BrO — CID 122372562
8-bromo-1,1,7,7-tetraethyl-4-hexoxy-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene (PubChem CID 122372562) has the molecular formula C30H49BrO and a molecular weight of 505.63 g/mol. Its IUPAC name is 8-bromo-1,1,7,7-tetraethyl-4-hexoxy-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene.
| Compound Name | 8-bromo-1,1,7,7-tetraethyl-4-hexoxy-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene |
|---|---|
| PubChem CID | 122372562 |
| Molecular Formula | C30H49BrO |
| Molecular Weight | 505.63 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 8-bromo-1,1,7,7-tetraethyl-4-hexoxy-3,3,5,5-tetramethyl-2,6-dihydro-s-indacene |
| SMILES | CCCCCCOc1c2c(c(Br)c3c1C(C)(C)CC3(CC)CC)C(CC)(CC)CC2(C)C |
| InChI | InChI=1S/C30H49BrO/c1-10-15-16-17-18-32-26-23-21(29(11-2,12-3)19-27(23,6)7)25(31)22-24(26)28(8,9)20-30(22,13-4)14-5/h10-20H2,1-9H3 |
| InChIKey | DEWXTPWYJLWBPI-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.63 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|