C14H13NOS — CID 122372877
(3R,4S)-1-methyl-4-phenyl-3-thiophen-2-ylazetidin-2-one (PubChem CID 122372877) has the molecular formula C14H13NOS and a molecular weight of 243.33 g/mol. Its IUPAC name is (3R,4S)-1-methyl-4-phenyl-3-thiophen-2-ylazetidin-2-one.
| Compound Name | (3R,4S)-1-methyl-4-phenyl-3-thiophen-2-ylazetidin-2-one |
|---|---|
| PubChem CID | 122372877 |
| Molecular Formula | C14H13NOS |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | (3R,4S)-1-methyl-4-phenyl-3-thiophen-2-ylazetidin-2-one |
| SMILES | CN1C(=O)[C@H](c2cccs2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C14H13NOS/c1-15-13(10-6-3-2-4-7-10)12(14(15)16)11-8-5-9-17-11/h2-9,12-13H,1H3/t12-,13-/m1/s1 |
| InChIKey | WYCKVMDNOBOIAX-CHWSQXEVSA-N |
| XLogP | 3.05 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |