About (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid
(2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid (PubChem CID 122373140) has the molecular formula C10H15F3O3
and a molecular weight of 240.22 g/mol. Its IUPAC name is (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid.
Molecular Properties
| Compound Name | (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid |
| PubChem CID | 122373140 |
| Molecular Formula | C10H15F3O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid |
| SMILES | O=C(O)[C@H]([C@@H](O)C1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C10H15F3O3/c11-10(12,13)7(9(15)16)8(14)6-4-2-1-3-5-6/h6-8,14H,1-5H2,(H,15,16)/t7-,8-/m0/s1 |
| InChIKey | MVWNBRPQNFJVFA-YUMQZZPRSA-N |
| XLogP | 2.19 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid?
The IUPAC name of (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid (CID 122373140) is (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid.
What is the SMILES notation for (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid?
The canonical SMILES for (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid is O=C(O)[C@H]([C@@H](O)C1CCCCC1)C(F)(F)F.
What is the InChIKey of (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid?
The InChIKey is MVWNBRPQNFJVFA-YUMQZZPRSA-N. The full InChI is InChI=1S/C10H15F3O3/c11-10(12,13)7(9(15)16)8(14)6-4-2-1-3-5-6/h6-8,14H,1-5H2,(H,15,16)/t7-,8-/m0/s1.
What are the key properties of (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid?
(2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid has a molecular weight of 240.22 g/mol, XLogP of 2.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(S)-cyclohexyl(hydroxy)methyl]-3,3,3-trifluoropropanoic acid is sourced from PubChem (CID 122373140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).