About methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate
methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate (PubChem CID 122373149) has the molecular formula C31H25NO2
and a molecular weight of 443.55 g/mol. Its IUPAC name is methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate |
| PubChem CID | 122373149 |
| Molecular Formula | C31H25NO2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate |
| SMILES | C#CCC1(CC#C)Cc2cc(-c3ccccc3)c(-n3cc(C(=O)OC)c4ccccc43)cc2C1 |
| InChI | InChI=1S/C31H25NO2/c1-4-15-31(16-5-2)19-23-17-26(22-11-7-6-8-12-22)29(18-24(23)20-31)32-21-27(30(33)34-3)25-13-9-10-14-28(25)32/h1-2,6-14,17-18,21H,15-16,19-20H2,3H3 |
| InChIKey | FDOSNMVQACEDDT-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate?
The IUPAC name of methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate (CID 122373149) is methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate.
What is the SMILES notation for methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate?
The canonical SMILES for methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate is C#CCC1(CC#C)Cc2cc(-c3ccccc3)c(-n3cc(C(=O)OC)c4ccccc43)cc2C1.
What is the InChIKey of methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate?
The InChIKey is FDOSNMVQACEDDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H25NO2/c1-4-15-31(16-5-2)19-23-17-26(22-11-7-6-8-12-22)29(18-24(23)20-31)32-21-27(30(33)34-3)25-13-9-10-14-28(25)32/h1-2,6-14,17-18,21H,15-16,19-20H2,3H3.
What are the key properties of methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate?
methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate has a molecular weight of 443.55 g/mol, XLogP of 6.22, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[6-phenyl-2,2-bis(prop-2-ynyl)-1,3-dihydroinden-5-yl]indole-3-carboxylate is sourced from PubChem (CID 122373149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).