C21H32O2Si — CID 122373635
3-[2-[(1S,2S,6R,7S,8R)-2,5,5,8-tetramethyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodec-9-en-7-yl]ethyl]cyclopent-2-en-1-one (PubChem CID 122373635) has the molecular formula C21H32O2Si and a molecular weight of 344.57 g/mol. Its IUPAC name is 3-[2-[(1S,2S,6R,7S,8R)-2,5,5,8-tetramethyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodec-9-en-7-yl]ethyl]cyclopent-2-en-1-one.
| Compound Name | 3-[2-[(1S,2S,6R,7S,8R)-2,5,5,8-tetramethyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodec-9-en-7-yl]ethyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 122373635 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 3-[2-[(1S,2S,6R,7S,8R)-2,5,5,8-tetramethyl-4-oxa-5-silatricyclo[6.2.2.01,6]dodec-9-en-7-yl]ethyl]cyclopent-2-en-1-one |
| SMILES | C[C@@H]1CO[Si](C)(C)[C@@H]2[C@@H](CCC3=CC(=O)CC3)[C@@]3(C)C=C[C@@]12CC3 |
| InChI | InChI=1S/C21H32O2Si/c1-15-14-23-24(3,4)19-18(8-6-16-5-7-17(22)13-16)20(2)9-11-21(15,19)12-10-20/h9,11,13,15,18-19H,5-8,10,12,14H2,1-4H3/t15-,18-,19-,20+,21-/m1/s1 |
| InChIKey | DAVMXFRADZNNPN-TZSPXAHUSA-N |
| XLogP | 5.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|