C8H15N5O2S — CID 122373744
3-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethylsulfanyl]propane-1,2-diol (PubChem CID 122373744) has the molecular formula C8H15N5O2S and a molecular weight of 245.31 g/mol. Its IUPAC name is 3-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethylsulfanyl]propane-1,2-diol.
| Compound Name | 3-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethylsulfanyl]propane-1,2-diol |
|---|---|
| PubChem CID | 122373744 |
| Molecular Formula | C8H15N5O2S |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 3-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethylsulfanyl]propane-1,2-diol |
| SMILES | Nc1nc(N)nc(CCSCC(O)CO)n1 |
| InChI | InChI=1S/C8H15N5O2S/c9-7-11-6(12-8(10)13-7)1-2-16-4-5(15)3-14/h5,14-15H,1-4H2,(H4,9,10,11,12,13) |
| InChIKey | PYQSCNWTJQPDKR-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|