C34H30N2O6 — CID 122373772
6,13-bis(4-butoxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone (PubChem CID 122373772) has the molecular formula C34H30N2O6 and a molecular weight of 562.62 g/mol. Its IUPAC name is 6,13-bis(4-butoxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone.
| Compound Name | 6,13-bis(4-butoxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
|---|---|
| PubChem CID | 122373772 |
| Molecular Formula | C34H30N2O6 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | 6,13-bis(4-butoxyphenyl)-6,13-diazatetracyclo[6.6.2.04,16.011,15]hexadeca-1(15),2,4(16),8,10-pentaene-5,7,12,14-tetrone |
| SMILES | CCCCOc1ccc(N2C(=O)c3ccc4c5c(ccc(c35)C2=O)C(=O)N(c2ccc(OCCCC)cc2)C4=O)cc1 |
| InChI | InChI=1S/C34H30N2O6/c1-3-5-19-41-23-11-7-21(8-12-23)35-31(37)25-15-17-27-30-28(18-16-26(29(25)30)32(35)38)34(40)36(33(27)39)22-9-13-24(14-10-22)42-20-6-4-2/h7-18H,3-6,19-20H2,1-2H3 |
| InChIKey | HBZUCVUIMVXXQQ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|