C11H10N2O3 — CID 122374287
2-methyl-4-nitro-2-azatricyclo[5.2.2.01,5]undeca-4,8,10-trien-3-one (PubChem CID 122374287) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 2-methyl-4-nitro-2-azatricyclo[5.2.2.01,5]undeca-4,8,10-trien-3-one.
| Compound Name | 2-methyl-4-nitro-2-azatricyclo[5.2.2.01,5]undeca-4,8,10-trien-3-one |
|---|---|
| PubChem CID | 122374287 |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 2-methyl-4-nitro-2-azatricyclo[5.2.2.01,5]undeca-4,8,10-trien-3-one |
| SMILES | CN1C(=O)C([N+](=O)[O-])=C2CC3C=CC21C=C3 |
| InChI | InChI=1S/C11H10N2O3/c1-12-10(14)9(13(15)16)8-6-7-2-4-11(8,12)5-3-7/h2-5,7H,6H2,1H3 |
| InChIKey | SHJMJDNHRGEQDS-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|