C11H16O4 — CID 122374715
(3R,6S,7S)-6,7-dihydroxy-3,7-dimethyl-3,4,5,6-tetrahydro-1H-isochromen-8-one (PubChem CID 122374715) has the molecular formula C11H16O4 and a molecular weight of 212.24 g/mol. Its IUPAC name is (3R,6S,7S)-6,7-dihydroxy-3,7-dimethyl-3,4,5,6-tetrahydro-1H-isochromen-8-one.
| Compound Name | (3R,6S,7S)-6,7-dihydroxy-3,7-dimethyl-3,4,5,6-tetrahydro-1H-isochromen-8-one |
|---|---|
| PubChem CID | 122374715 |
| Molecular Formula | C11H16O4 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3R,6S,7S)-6,7-dihydroxy-3,7-dimethyl-3,4,5,6-tetrahydro-1H-isochromen-8-one |
| SMILES | C[C@@H]1CC2=C(CO1)C(=O)[C@@](C)(O)[C@@H](O)C2 |
| InChI | InChI=1S/C11H16O4/c1-6-3-7-4-9(12)11(2,14)10(13)8(7)5-15-6/h6,9,12,14H,3-5H2,1-2H3/t6-,9+,11+/m1/s1 |
| InChIKey | WUTMPUKLLJPVCV-PUMQYWBSSA-N |
| XLogP | 0.18 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |