C15H12N2O — CID 122375454
8-oxido-14-aza-8-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene (PubChem CID 122375454) has the molecular formula C15H12N2O and a molecular weight of 236.27 g/mol. Its IUPAC name is 8-oxido-14-aza-8-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene.
| Compound Name | 8-oxido-14-aza-8-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene |
|---|---|
| PubChem CID | 122375454 |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 8-oxido-14-aza-8-azoniatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,8,13,15-heptaene |
| SMILES | [O-][n+]1c2c3c(nccc3c3ccccc31)CCC2 |
| InChI | InChI=1S/C15H12N2O/c18-17-13-6-2-1-4-10(13)11-8-9-16-12-5-3-7-14(17)15(11)12/h1-2,4,6,8-9H,3,5,7H2 |
| InChIKey | BFVGFHUIQDZQOG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|