About 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one
1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one (PubChem CID 122375671) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one.
Molecular Properties
| Compound Name | 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one |
| PubChem CID | 122375671 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one |
| SMILES | C/C=C/CCC(=O)N1C=CC(=O)CC1 |
| InChI | InChI=1S/C11H15NO2/c1-2-3-4-5-11(14)12-8-6-10(13)7-9-12/h2-3,6,8H,4-5,7,9H2,1H3/b3-2+ |
| InChIKey | QVZRHJBLBYDUOC-NSCUHMNNSA-N |
| XLogP | 1.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one?
The IUPAC name of 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one (CID 122375671) is 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one.
What is the SMILES notation for 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one?
The canonical SMILES for 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one is C/C=C/CCC(=O)N1C=CC(=O)CC1.
What is the InChIKey of 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one?
The InChIKey is QVZRHJBLBYDUOC-NSCUHMNNSA-N. The full InChI is InChI=1S/C11H15NO2/c1-2-3-4-5-11(14)12-8-6-10(13)7-9-12/h2-3,6,8H,4-5,7,9H2,1H3/b3-2+.
What are the key properties of 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one?
1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one has a molecular weight of 193.25 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-hex-4-enoyl]-2,3-dihydropyridin-4-one is sourced from PubChem (CID 122375671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).