C24H34O4S4 — CID 122375705
5-hexylsulfanyl-7-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine (PubChem CID 122375705) has the molecular formula C24H34O4S4 and a molecular weight of 514.80 g/mol. Its IUPAC name is 5-hexylsulfanyl-7-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine.
| Compound Name | 5-hexylsulfanyl-7-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
|---|---|
| PubChem CID | 122375705 |
| Molecular Formula | C24H34O4S4 |
| Molecular Weight | 514.80 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 5-hexylsulfanyl-7-(5-hexylsulfanyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxine |
| SMILES | CCCCCCSc1sc(-c2sc(SCCCCCC)c3c2OCCO3)c2c1OCCO2 |
| InChI | InChI=1S/C24H34O4S4/c1-3-5-7-9-15-29-23-19-17(25-11-13-27-19)21(31-23)22-18-20(28-14-12-26-18)24(32-22)30-16-10-8-6-4-2/h3-16H2,1-2H3 |
| InChIKey | GWSSQWAIWYVGOX-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.80 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|