About 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran
7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran (PubChem CID 122375850) has the molecular formula C8H10OS
and a molecular weight of 154.23 g/mol. Its IUPAC name is 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran.
Molecular Properties
| Compound Name | 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran |
| PubChem CID | 122375850 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran |
| SMILES | CC1OCCc2ccsc21 |
| InChI | InChI=1S/C8H10OS/c1-6-8-7(2-4-9-6)3-5-10-8/h3,5-6H,2,4H2,1H3 |
| InChIKey | XMPHARINCOAZFB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran?
The IUPAC name of 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran (CID 122375850) is 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran.
What is the SMILES notation for 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran?
The canonical SMILES for 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran is CC1OCCc2ccsc21.
What is the InChIKey of 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran?
The InChIKey is XMPHARINCOAZFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS/c1-6-8-7(2-4-9-6)3-5-10-8/h3,5-6H,2,4H2,1H3.
What are the key properties of 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran?
7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran has a molecular weight of 154.23 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5,7-dihydro-4H-thieno[2,3-c]pyran is sourced from PubChem (CID 122375850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).