C31H41NO8Si — CID 122376517
2-O-ethyl 1-O-methyl (1R,2S,3S)-1-(1,3-dioxoisoindol-2-yl)-3-[(1Z)-2-tri(propan-2-yl)silyloxycarbonylpenta-1,4-dienyl]cyclopropane-1,2-dicarboxylate (PubChem CID 122376517) has the molecular formula C31H41NO8Si and a molecular weight of 583.75 g/mol. Its IUPAC name is 2-O-ethyl 1-O-methyl (1R,2S,3S)-1-(1,3-dioxoisoindol-2-yl)-3-[(1Z)-2-tri(propan-2-yl)silyloxycarbonylpenta-1,4-dienyl]cyclopropane-1,2-dicarboxylate.
| Compound Name | 2-O-ethyl 1-O-methyl (1R,2S,3S)-1-(1,3-dioxoisoindol-2-yl)-3-[(1Z)-2-tri(propan-2-yl)silyloxycarbonylpenta-1,4-dienyl]cyclopropane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 122376517 |
| Molecular Formula | C31H41NO8Si |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | 2-O-ethyl 1-O-methyl (1R,2S,3S)-1-(1,3-dioxoisoindol-2-yl)-3-[(1Z)-2-tri(propan-2-yl)silyloxycarbonylpenta-1,4-dienyl]cyclopropane-1,2-dicarboxylate |
| SMILES | C=CC/C(=C/[C@H]1[C@H](C(=O)OCC)[C@]1(C(=O)OC)N1C(=O)c2ccccc2C1=O)C(=O)O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C31H41NO8Si/c1-10-14-21(28(35)40-41(18(3)4,19(5)6)20(7)8)17-24-25(29(36)39-11-2)31(24,30(37)38-9)32-26(33)22-15-12-13-16-23(22)27(32)34/h10,12-13,15-20,24-25H,1,11,14H2,2-9H3/b21-17-/t24-,25+,31+/m0/s1 |
| InChIKey | SDQNSXCXCUMKRH-MZWGTWPRSA-N |
| XLogP | 5.22 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|