C34H16Br2Cl2N2O2 — CID 122377325
3,6-bis(4-bromobenzoyl)-4,5-bis(2-chlorophenyl)benzene-1,2-dicarbonitrile (PubChem CID 122377325) has the molecular formula C34H16Br2Cl2N2O2 and a molecular weight of 715.23 g/mol. Its IUPAC name is 3,6-bis(4-bromobenzoyl)-4,5-bis(2-chlorophenyl)benzene-1,2-dicarbonitrile.
| Compound Name | 3,6-bis(4-bromobenzoyl)-4,5-bis(2-chlorophenyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 122377325 |
| Molecular Formula | C34H16Br2Cl2N2O2 |
| Molecular Weight | 715.23 g/mol |
| Exact Mass | 711.90 |
| IUPAC Name | 3,6-bis(4-bromobenzoyl)-4,5-bis(2-chlorophenyl)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1c(C#N)c(C(=O)c2ccc(Br)cc2)c(-c2ccccc2Cl)c(-c2ccccc2Cl)c1C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C34H16Br2Cl2N2O2/c35-21-13-9-19(10-14-21)33(41)31-25(17-39)26(18-40)32(34(42)20-11-15-22(36)16-12-20)30(24-6-2-4-8-28(24)38)29(31)23-5-1-3-7-27(23)37/h1-16H |
| InChIKey | AQAPKOSPOIGRCW-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.23 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |