About pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone
pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone (PubChem CID 122377366) has the molecular formula C10H5Cl3N2O
and a molecular weight of 275.52 g/mol. Its IUPAC name is pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone.
Molecular Properties
| Compound Name | pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone |
| PubChem CID | 122377366 |
| Molecular Formula | C10H5Cl3N2O |
| Molecular Weight | 275.52 g/mol |
| Exact Mass | 273.95 |
| IUPAC Name | pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone |
| SMILES | O=C(c1c(Cl)cc(Cl)cc1Cl)n1cccn1 |
| InChI | InChI=1S/C10H5Cl3N2O/c11-6-4-7(12)9(8(13)5-6)10(16)15-3-1-2-14-15/h1-5H |
| InChIKey | OHZZGSIBPTURDS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.52 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone?
The IUPAC name of pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone (CID 122377366) is pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone.
What is the SMILES notation for pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone?
The canonical SMILES for pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone is O=C(c1c(Cl)cc(Cl)cc1Cl)n1cccn1.
What is the InChIKey of pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone?
The InChIKey is OHZZGSIBPTURDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5Cl3N2O/c11-6-4-7(12)9(8(13)5-6)10(16)15-3-1-2-14-15/h1-5H.
What are the key properties of pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone?
pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone has a molecular weight of 275.52 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazol-1-yl-(2,4,6-trichlorophenyl)methanone is sourced from PubChem (CID 122377366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).